C28H24N2O2 — CID 4944335
N-(3,4-dimethylphenyl)-2-[(4-phenylbenzoyl)amino]benzamide (PubChem CID 4944335) has the molecular formula C28H24N2O2 and a molecular weight of 420.51 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[(4-phenylbenzoyl)amino]benzamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[(4-phenylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 4944335 |
| Molecular Formula | C28H24N2O2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[(4-phenylbenzoyl)amino]benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2NC(=O)c2ccc(-c3ccccc3)cc2)cc1C |
| InChI | InChI=1S/C28H24N2O2/c1-19-12-17-24(18-20(19)2)29-28(32)25-10-6-7-11-26(25)30-27(31)23-15-13-22(14-16-23)21-8-4-3-5-9-21/h3-18H,1-2H3,(H,29,32)(H,30,31) |
| InChIKey | MZNFLKWOGTYAGE-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |