C22H19N3O4 — CID 4944387
N-(3,4-dimethylphenyl)-2-[(3-nitrobenzoyl)amino]benzamide (PubChem CID 4944387) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[(3-nitrobenzoyl)amino]benzamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[(3-nitrobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 4944387 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[(3-nitrobenzoyl)amino]benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2NC(=O)c2cccc([N+](=O)[O-])c2)cc1C |
| InChI | InChI=1S/C22H19N3O4/c1-14-10-11-17(12-15(14)2)23-22(27)19-8-3-4-9-20(19)24-21(26)16-6-5-7-18(13-16)25(28)29/h3-13H,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | ZKZIIOHNMDZJKV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|