C23H22N2O4 — CID 110602599
N-(3,4-dimethoxyphenyl)-2-[(4-methylbenzoyl)amino]benzamide (PubChem CID 110602599) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-[(4-methylbenzoyl)amino]benzamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-[(4-methylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 110602599 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-[(4-methylbenzoyl)amino]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2NC(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C23H22N2O4/c1-15-8-10-16(11-9-15)22(26)25-19-7-5-4-6-18(19)23(27)24-17-12-13-20(28-2)21(14-17)29-3/h4-14H,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | AIZKXNDGWQEGIM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |