C17H17NO4 — CID 17394178
N-(2-acetylphenyl)-3,4-dimethoxybenzamide (PubChem CID 17394178) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is N-(2-acetylphenyl)-3,4-dimethoxybenzamide.
| Compound Name | N-(2-acetylphenyl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 17394178 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-(2-acetylphenyl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2C(C)=O)cc1OC |
| InChI | InChI=1S/C17H17NO4/c1-11(19)13-6-4-5-7-14(13)18-17(20)12-8-9-15(21-2)16(10-12)22-3/h4-10H,1-3H3,(H,18,20) |
| InChIKey | AYJJKIPKRCADJJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |