C23H21ClN2O5 — CID 2185661
N-[2-[(3-chloro-4-methoxyphenyl)carbamoyl]phenyl]-3,4-dimethoxybenzamide (PubChem CID 2185661) has the molecular formula C23H21ClN2O5 and a molecular weight of 440.88 g/mol. Its IUPAC name is N-[2-[(3-chloro-4-methoxyphenyl)carbamoyl]phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[(3-chloro-4-methoxyphenyl)carbamoyl]phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 2185661 |
| Molecular Formula | C23H21ClN2O5 |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | N-[2-[(3-chloro-4-methoxyphenyl)carbamoyl]phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2NC(=O)c2ccc(OC)c(OC)c2)cc1Cl |
| InChI | InChI=1S/C23H21ClN2O5/c1-29-19-11-9-15(13-17(19)24)25-23(28)16-6-4-5-7-18(16)26-22(27)14-8-10-20(30-2)21(12-14)31-3/h4-13H,1-3H3,(H,25,28)(H,26,27) |
| InChIKey | BHKCWBGFYWLWEC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |