C21H19ClN2O3 — CID 112986928
N-[4-(2-chloroanilino)phenyl]-3,4-dimethoxybenzamide (PubChem CID 112986928) has the molecular formula C21H19ClN2O3 and a molecular weight of 382.85 g/mol. Its IUPAC name is N-[4-(2-chloroanilino)phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-(2-chloroanilino)phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 112986928 |
| Molecular Formula | C21H19ClN2O3 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | N-[4-(2-chloroanilino)phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(Nc3ccccc3Cl)cc2)cc1OC |
| InChI | InChI=1S/C21H19ClN2O3/c1-26-19-12-7-14(13-20(19)27-2)21(25)24-16-10-8-15(9-11-16)23-18-6-4-3-5-17(18)22/h3-13,23H,1-2H3,(H,24,25) |
| InChIKey | NXQSYPJHWZNLKN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |