C22H21ClN2O3 — CID 112986934
N-[4-(2-chloroanilino)phenyl]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 112986934) has the molecular formula C22H21ClN2O3 and a molecular weight of 396.87 g/mol. Its IUPAC name is N-[4-(2-chloroanilino)phenyl]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[4-(2-chloroanilino)phenyl]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 112986934 |
| Molecular Formula | C22H21ClN2O3 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-[4-(2-chloroanilino)phenyl]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(Nc3ccccc3Cl)cc2)cc1OC |
| InChI | InChI=1S/C22H21ClN2O3/c1-27-20-12-7-15(13-21(20)28-2)14-22(26)25-17-10-8-16(9-11-17)24-19-6-4-3-5-18(19)23/h3-13,24H,14H2,1-2H3,(H,25,26) |
| InChIKey | CIGUZPDQWHUAML-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |