C24H25N3O4 — CID 174759764
2-(3,4-dimethoxyphenyl)-N-[4-[(2-methylanilino)carbamoyl]phenyl]acetamide (PubChem CID 174759764) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[4-[(2-methylanilino)carbamoyl]phenyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[4-[(2-methylanilino)carbamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 174759764 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[4-[(2-methylanilino)carbamoyl]phenyl]acetamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(C(=O)NNc3ccccc3C)cc2)cc1OC |
| InChI | InChI=1S/C24H25N3O4/c1-16-6-4-5-7-20(16)26-27-24(29)18-9-11-19(12-10-18)25-23(28)15-17-8-13-21(30-2)22(14-17)31-3/h4-14,26H,15H2,1-3H3,(H,25,28)(H,27,29) |
| InChIKey | FZUOGVZGVIMADW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|