C23H21ClN2O3 — CID 31967245
4-chloro-N-[2-[[2-(3-methoxy-4-methylphenyl)acetyl]amino]phenyl]benzamide (PubChem CID 31967245) has the molecular formula C23H21ClN2O3 and a molecular weight of 408.89 g/mol. Its IUPAC name is 4-chloro-N-[2-[[2-(3-methoxy-4-methylphenyl)acetyl]amino]phenyl]benzamide.
| Compound Name | 4-chloro-N-[2-[[2-(3-methoxy-4-methylphenyl)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 31967245 |
| Molecular Formula | C23H21ClN2O3 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 4-chloro-N-[2-[[2-(3-methoxy-4-methylphenyl)acetyl]amino]phenyl]benzamide |
| SMILES | COc1cc(CC(=O)Nc2ccccc2NC(=O)c2ccc(Cl)cc2)ccc1C |
| InChI | InChI=1S/C23H21ClN2O3/c1-15-7-8-16(13-21(15)29-2)14-22(27)25-19-5-3-4-6-20(19)26-23(28)17-9-11-18(24)12-10-17/h3-13H,14H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | RVNSQGVQJXKSGA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |