C23H19ClN2O4 — CID 17361899
2-[[3-[[2-(4-chlorophenyl)acetyl]amino]-4-methylbenzoyl]amino]benzoic acid (PubChem CID 17361899) has the molecular formula C23H19ClN2O4 and a molecular weight of 422.87 g/mol. Its IUPAC name is 2-[[3-[[2-(4-chlorophenyl)acetyl]amino]-4-methylbenzoyl]amino]benzoic acid.
| Compound Name | 2-[[3-[[2-(4-chlorophenyl)acetyl]amino]-4-methylbenzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 17361899 |
| Molecular Formula | C23H19ClN2O4 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 2-[[3-[[2-(4-chlorophenyl)acetyl]amino]-4-methylbenzoyl]amino]benzoic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2C(=O)O)cc1NC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H19ClN2O4/c1-14-6-9-16(22(28)26-19-5-3-2-4-18(19)23(29)30)13-20(14)25-21(27)12-15-7-10-17(24)11-8-15/h2-11,13H,12H2,1H3,(H,25,27)(H,26,28)(H,29,30) |
| InChIKey | RJGMVJSDNYSMSK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |