C30H27N3O3 — CID 46410067
3-benzamido-4-methyl-N-[2-(2-phenylethylcarbamoyl)phenyl]benzamide (PubChem CID 46410067) has the molecular formula C30H27N3O3 and a molecular weight of 477.56 g/mol. Its IUPAC name is 3-benzamido-4-methyl-N-[2-(2-phenylethylcarbamoyl)phenyl]benzamide.
| Compound Name | 3-benzamido-4-methyl-N-[2-(2-phenylethylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 46410067 |
| Molecular Formula | C30H27N3O3 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 3-benzamido-4-methyl-N-[2-(2-phenylethylcarbamoyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2C(=O)NCCc2ccccc2)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H27N3O3/c1-21-16-17-24(20-27(21)33-28(34)23-12-6-3-7-13-23)29(35)32-26-15-9-8-14-25(26)30(36)31-19-18-22-10-4-2-5-11-22/h2-17,20H,18-19H2,1H3,(H,31,36)(H,32,35)(H,33,34) |
| InChIKey | RWBRCOHUIHKPDJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |