C27H27N3O4 — CID 17226585
3-benzamido-4-methyl-N-[2-(oxolan-2-ylmethylcarbamoyl)phenyl]benzamide (PubChem CID 17226585) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 3-benzamido-4-methyl-N-[2-(oxolan-2-ylmethylcarbamoyl)phenyl]benzamide.
| Compound Name | 3-benzamido-4-methyl-N-[2-(oxolan-2-ylmethylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17226585 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 3-benzamido-4-methyl-N-[2-(oxolan-2-ylmethylcarbamoyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2C(=O)NCC2CCCO2)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H27N3O4/c1-18-13-14-20(16-24(18)30-25(31)19-8-3-2-4-9-19)26(32)29-23-12-6-5-11-22(23)27(33)28-17-21-10-7-15-34-21/h2-6,8-9,11-14,16,21H,7,10,15,17H2,1H3,(H,28,33)(H,29,32)(H,30,31) |
| InChIKey | XKZXNJLCKQPOOA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |