C26H25N3O4 — CID 17321274
2-[(3-benzamidobenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 17321274) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-[(3-benzamidobenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-[(3-benzamidobenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 17321274 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-[(3-benzamidobenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(Nc1cccc(C(=O)Nc2ccccc2C(=O)NCC2CCCO2)c1)c1ccccc1 |
| InChI | InChI=1S/C26H25N3O4/c30-24(18-8-2-1-3-9-18)28-20-11-6-10-19(16-20)25(31)29-23-14-5-4-13-22(23)26(32)27-17-21-12-7-15-33-21/h1-6,8-11,13-14,16,21H,7,12,15,17H2,(H,27,32)(H,28,30)(H,29,31) |
| InChIKey | XJDVHRVSJSDPCI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |