C20H19F3N2O3 — CID 43013842
N-(oxolan-2-ylmethyl)-2-[[4-(trifluoromethyl)benzoyl]amino]benzamide (PubChem CID 43013842) has the molecular formula C20H19F3N2O3 and a molecular weight of 392.38 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-2-[[4-(trifluoromethyl)benzoyl]amino]benzamide.
| Compound Name | N-(oxolan-2-ylmethyl)-2-[[4-(trifluoromethyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 43013842 |
| Molecular Formula | C20H19F3N2O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-2-[[4-(trifluoromethyl)benzoyl]amino]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCC1CCCO1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H19F3N2O3/c21-20(22,23)14-9-7-13(8-10-14)18(26)25-17-6-2-1-5-16(17)19(27)24-12-15-4-3-11-28-15/h1-2,5-10,15H,3-4,11-12H2,(H,24,27)(H,25,26) |
| InChIKey | JOHBXUZPERWITC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |