C22H24N2O4 — CID 40768505
N-[[(2R)-oxolan-2-yl]methyl]-2-[(4-prop-2-enoxybenzoyl)amino]benzamide (PubChem CID 40768505) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is N-[[(2R)-oxolan-2-yl]methyl]-2-[(4-prop-2-enoxybenzoyl)amino]benzamide.
| Compound Name | N-[[(2R)-oxolan-2-yl]methyl]-2-[(4-prop-2-enoxybenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 40768505 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[[(2R)-oxolan-2-yl]methyl]-2-[(4-prop-2-enoxybenzoyl)amino]benzamide |
| SMILES | C=CCOc1ccc(C(=O)Nc2ccccc2C(=O)NC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-2-13-27-17-11-9-16(10-12-17)21(25)24-20-8-4-3-7-19(20)22(26)23-15-18-6-5-14-28-18/h2-4,7-12,18H,1,5-6,13-15H2,(H,23,26)(H,24,25)/t18-/m1/s1 |
| InChIKey | KQLNYCLLHCLCFH-GOSISDBHSA-N |
| XLogP | 3.41 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|