C26H34N2O4 — CID 4950696
2-[(4-heptoxybenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 4950696) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-[(4-heptoxybenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-[(4-heptoxybenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 4950696 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 2-[(4-heptoxybenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)Nc2ccccc2C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C26H34N2O4/c1-2-3-4-5-8-17-31-21-15-13-20(14-16-21)25(29)28-24-12-7-6-11-23(24)26(30)27-19-22-10-9-18-32-22/h6-7,11-16,22H,2-5,8-10,17-19H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | QNPXROLGXSJFOE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|