C18H26N2O3S — CID 8714560
N-[[(2R)-oxolan-2-yl]methylcarbamothioyl]-4-pentoxybenzamide (PubChem CID 8714560) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is N-[[(2R)-oxolan-2-yl]methylcarbamothioyl]-4-pentoxybenzamide.
| Compound Name | N-[[(2R)-oxolan-2-yl]methylcarbamothioyl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 8714560 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | N-[[(2R)-oxolan-2-yl]methylcarbamothioyl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)NC(=S)NC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C18H26N2O3S/c1-2-3-4-11-22-15-9-7-14(8-10-15)17(21)20-18(24)19-13-16-6-5-12-23-16/h7-10,16H,2-6,11-13H2,1H3,(H2,19,20,21,24)/t16-/m1/s1 |
| InChIKey | YSGFCAGVHSLDMI-MRXNPFEDSA-N |
| XLogP | 3.04 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|