C17H24N2O3S — CID 4957060
3-butoxy-N-(oxolan-2-ylmethylcarbamothioyl)benzamide (PubChem CID 4957060) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is 3-butoxy-N-(oxolan-2-ylmethylcarbamothioyl)benzamide.
| Compound Name | 3-butoxy-N-(oxolan-2-ylmethylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 4957060 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 3-butoxy-N-(oxolan-2-ylmethylcarbamothioyl)benzamide |
| SMILES | CCCCOc1cccc(C(=O)NC(=S)NCC2CCCO2)c1 |
| InChI | InChI=1S/C17H24N2O3S/c1-2-3-9-21-14-7-4-6-13(11-14)16(20)19-17(23)18-12-15-8-5-10-22-15/h4,6-7,11,15H,2-3,5,8-10,12H2,1H3,(H2,18,19,20,23) |
| InChIKey | KYQLFWJPXQMOGO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|