C13H17NO3 — CID 669434
3-methoxy-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 669434) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 3-methoxy-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 3-methoxy-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 669434 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 3-methoxy-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | COc1cccc(C(=O)NC[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C13H17NO3/c1-16-11-5-2-4-10(8-11)13(15)14-9-12-6-3-7-17-12/h2,4-5,8,12H,3,6-7,9H2,1H3,(H,14,15)/t12-/m0/s1 |
| InChIKey | CXNMRTSCFAKPIT-LBPRGKRZSA-N |
| XLogP | 1.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |