C23H23N3O4 — CID 46386589
3-[4-(3-methoxyphenoxy)pyrimidin-2-yl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 46386589) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is 3-[4-(3-methoxyphenoxy)pyrimidin-2-yl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-[4-(3-methoxyphenoxy)pyrimidin-2-yl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 46386589 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 3-[4-(3-methoxyphenoxy)pyrimidin-2-yl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COc1cccc(Oc2ccnc(-c3cccc(C(=O)NCC4CCCO4)c3)n2)c1 |
| InChI | InChI=1S/C23H23N3O4/c1-28-18-7-3-8-19(14-18)30-21-10-11-24-22(26-21)16-5-2-6-17(13-16)23(27)25-15-20-9-4-12-29-20/h2-3,5-8,10-11,13-14,20H,4,9,12,15H2,1H3,(H,25,27) |
| InChIKey | JMPFVGKBWAXLKG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |