C18H20N2O3 — CID 126446000
3-(6-methoxy-3-pyridinyl)-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 126446000) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-(6-methoxy-3-pyridinyl)-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 3-(6-methoxy-3-pyridinyl)-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 126446000 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3-(6-methoxy-3-pyridinyl)-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | COc1ccc(-c2cccc(C(=O)NC[C@@H]3CCCO3)c2)cn1 |
| InChI | InChI=1S/C18H20N2O3/c1-22-17-8-7-15(11-19-17)13-4-2-5-14(10-13)18(21)20-12-16-6-3-9-23-16/h2,4-5,7-8,10-11,16H,3,6,9,12H2,1H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | DQCLSQJPKUWDPF-INIZCTEOSA-N |
| XLogP | 2.67 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |