C21H26N2O2S — CID 4957024
3-butoxy-N-[(2,4,6-trimethylphenyl)carbamothioyl]benzamide (PubChem CID 4957024) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is 3-butoxy-N-[(2,4,6-trimethylphenyl)carbamothioyl]benzamide.
| Compound Name | 3-butoxy-N-[(2,4,6-trimethylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4957024 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 3-butoxy-N-[(2,4,6-trimethylphenyl)carbamothioyl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)NC(=S)Nc2c(C)cc(C)cc2C)c1 |
| InChI | InChI=1S/C21H26N2O2S/c1-5-6-10-25-18-9-7-8-17(13-18)20(24)23-21(26)22-19-15(3)11-14(2)12-16(19)4/h7-9,11-13H,5-6,10H2,1-4H3,(H2,22,23,24,26) |
| InChIKey | SKERKIXRJVGLGE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|