C22H27N3O3S — CID 4957132
2-[(3-butoxybenzoyl)carbamothioylamino]-N-propan-2-ylbenzamide (PubChem CID 4957132) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is 2-[(3-butoxybenzoyl)carbamothioylamino]-N-propan-2-ylbenzamide.
| Compound Name | 2-[(3-butoxybenzoyl)carbamothioylamino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 4957132 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 2-[(3-butoxybenzoyl)carbamothioylamino]-N-propan-2-ylbenzamide |
| SMILES | CCCCOc1cccc(C(=O)NC(=S)Nc2ccccc2C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C22H27N3O3S/c1-4-5-13-28-17-10-8-9-16(14-17)20(26)25-22(29)24-19-12-7-6-11-18(19)21(27)23-15(2)3/h6-12,14-15H,4-5,13H2,1-3H3,(H,23,27)(H2,24,25,26,29) |
| InChIKey | FAGAQUPSGMPYFY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|