C25H33N3O3S — CID 4951008
2-[(4-heptoxybenzoyl)carbamothioylamino]-N-propan-2-ylbenzamide (PubChem CID 4951008) has the molecular formula C25H33N3O3S and a molecular weight of 455.62 g/mol. Its IUPAC name is 2-[(4-heptoxybenzoyl)carbamothioylamino]-N-propan-2-ylbenzamide.
| Compound Name | 2-[(4-heptoxybenzoyl)carbamothioylamino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 4951008 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-[(4-heptoxybenzoyl)carbamothioylamino]-N-propan-2-ylbenzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C25H33N3O3S/c1-4-5-6-7-10-17-31-20-15-13-19(14-16-20)23(29)28-25(32)27-22-12-9-8-11-21(22)24(30)26-18(2)3/h8-9,11-16,18H,4-7,10,17H2,1-3H3,(H,26,30)(H2,27,28,29,32) |
| InChIKey | IUFCHDSOYOROAE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|