C21H24N2O4S — CID 4935744
methyl 2-[(4-pentoxybenzoyl)carbamothioylamino]benzoate (PubChem CID 4935744) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is methyl 2-[(4-pentoxybenzoyl)carbamothioylamino]benzoate.
| Compound Name | methyl 2-[(4-pentoxybenzoyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 4935744 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | methyl 2-[(4-pentoxybenzoyl)carbamothioylamino]benzoate |
| SMILES | CCCCCOc1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)OC)cc1 |
| InChI | InChI=1S/C21H24N2O4S/c1-3-4-7-14-27-16-12-10-15(11-13-16)19(24)23-21(28)22-18-9-6-5-8-17(18)20(25)26-2/h5-6,8-13H,3-4,7,14H2,1-2H3,(H2,22,23,24,28) |
| InChIKey | MFWIRAQKASBHOP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|