C23H29N3O3S — CID 4934165
2-[(4-hexoxybenzoyl)carbamothioylamino]-N,N-dimethylbenzamide (PubChem CID 4934165) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is 2-[(4-hexoxybenzoyl)carbamothioylamino]-N,N-dimethylbenzamide.
| Compound Name | 2-[(4-hexoxybenzoyl)carbamothioylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 4934165 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2-[(4-hexoxybenzoyl)carbamothioylamino]-N,N-dimethylbenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C23H29N3O3S/c1-4-5-6-9-16-29-18-14-12-17(13-15-18)21(27)25-23(30)24-20-11-8-7-10-19(20)22(28)26(2)3/h7-8,10-15H,4-6,9,16H2,1-3H3,(H2,24,25,27,30) |
| InChIKey | HFPZBZHKUYMJEB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|