C34H36N4O3S — CID 4951003
N-(4-anilinophenyl)-2-[(4-heptoxybenzoyl)carbamothioylamino]benzamide (PubChem CID 4951003) has the molecular formula C34H36N4O3S and a molecular weight of 580.75 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-[(4-heptoxybenzoyl)carbamothioylamino]benzamide.
| Compound Name | N-(4-anilinophenyl)-2-[(4-heptoxybenzoyl)carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 4951003 |
| Molecular Formula | C34H36N4O3S |
| Molecular Weight | 580.75 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | N-(4-anilinophenyl)-2-[(4-heptoxybenzoyl)carbamothioylamino]benzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)Nc2ccc(Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C34H36N4O3S/c1-2-3-4-5-11-24-41-29-22-16-25(17-23-29)32(39)38-34(42)37-31-15-10-9-14-30(31)33(40)36-28-20-18-27(19-21-28)35-26-12-7-6-8-13-26/h6-10,12-23,35H,2-5,11,24H2,1H3,(H,36,40)(H2,37,38,39,42) |
| InChIKey | VGBHCUSDZCFGKJ-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.75 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|