C29H25N3O3S — CID 4956837
N-phenyl-2-[[4-(2-phenylethoxy)benzoyl]carbamothioylamino]benzamide (PubChem CID 4956837) has the molecular formula C29H25N3O3S and a molecular weight of 495.60 g/mol. Its IUPAC name is N-phenyl-2-[[4-(2-phenylethoxy)benzoyl]carbamothioylamino]benzamide.
| Compound Name | N-phenyl-2-[[4-(2-phenylethoxy)benzoyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 4956837 |
| Molecular Formula | C29H25N3O3S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | N-phenyl-2-[[4-(2-phenylethoxy)benzoyl]carbamothioylamino]benzamide |
| SMILES | O=C(NC(=S)Nc1ccccc1C(=O)Nc1ccccc1)c1ccc(OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H25N3O3S/c33-27(22-15-17-24(18-16-22)35-20-19-21-9-3-1-4-10-21)32-29(36)31-26-14-8-7-13-25(26)28(34)30-23-11-5-2-6-12-23/h1-18H,19-20H2,(H,30,34)(H2,31,32,33,36) |
| InChIKey | NUXGIAQOBCQLMW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|