C24H22N2O5S — CID 4953056
methyl 2-[[4-(2-phenoxyethoxy)benzoyl]carbamothioylamino]benzoate (PubChem CID 4953056) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is methyl 2-[[4-(2-phenoxyethoxy)benzoyl]carbamothioylamino]benzoate.
| Compound Name | methyl 2-[[4-(2-phenoxyethoxy)benzoyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 4953056 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | methyl 2-[[4-(2-phenoxyethoxy)benzoyl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=S)NC(=O)c1ccc(OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N2O5S/c1-29-23(28)20-9-5-6-10-21(20)25-24(32)26-22(27)17-11-13-19(14-12-17)31-16-15-30-18-7-3-2-4-8-18/h2-14H,15-16H2,1H3,(H2,25,26,27,32) |
| InChIKey | FMDHEDZHMBOXDA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|