C25H25N3O5S — CID 17351324
N-(2-hydroxyethyl)-2-[[4-(2-phenoxyethoxy)benzoyl]carbamothioylamino]benzamide (PubChem CID 17351324) has the molecular formula C25H25N3O5S and a molecular weight of 479.56 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[[4-(2-phenoxyethoxy)benzoyl]carbamothioylamino]benzamide.
| Compound Name | N-(2-hydroxyethyl)-2-[[4-(2-phenoxyethoxy)benzoyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 17351324 |
| Molecular Formula | C25H25N3O5S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[[4-(2-phenoxyethoxy)benzoyl]carbamothioylamino]benzamide |
| SMILES | O=C(NC(=S)Nc1ccccc1C(=O)NCCO)c1ccc(OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O5S/c29-15-14-26-24(31)21-8-4-5-9-22(21)27-25(34)28-23(30)18-10-12-20(13-11-18)33-17-16-32-19-6-2-1-3-7-19/h1-13,29H,14-17H2,(H,26,31)(H2,27,28,30,34) |
| InChIKey | OWMXQCOUCMKFIS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|