C20H23N3O4S — CID 17351313
N-(2-hydroxyethyl)-2-[(4-propoxybenzoyl)carbamothioylamino]benzamide (PubChem CID 17351313) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[(4-propoxybenzoyl)carbamothioylamino]benzamide.
| Compound Name | N-(2-hydroxyethyl)-2-[(4-propoxybenzoyl)carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 17351313 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[(4-propoxybenzoyl)carbamothioylamino]benzamide |
| SMILES | CCCOc1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)NCCO)cc1 |
| InChI | InChI=1S/C20H23N3O4S/c1-2-13-27-15-9-7-14(8-10-15)18(25)23-20(28)22-17-6-4-3-5-16(17)19(26)21-11-12-24/h3-10,24H,2,11-13H2,1H3,(H,21,26)(H2,22,23,25,28) |
| InChIKey | MUGUTBLHVMXGKE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|