C31H29N3O3S — CID 4956940
2-[[4-(2-phenylethoxy)benzoyl]carbamothioylamino]-N-(2-phenylethyl)benzamide (PubChem CID 4956940) has the molecular formula C31H29N3O3S and a molecular weight of 523.66 g/mol. Its IUPAC name is 2-[[4-(2-phenylethoxy)benzoyl]carbamothioylamino]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-[[4-(2-phenylethoxy)benzoyl]carbamothioylamino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 4956940 |
| Molecular Formula | C31H29N3O3S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 2-[[4-(2-phenylethoxy)benzoyl]carbamothioylamino]-N-(2-phenylethyl)benzamide |
| SMILES | O=C(NC(=S)Nc1ccccc1C(=O)NCCc1ccccc1)c1ccc(OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H29N3O3S/c35-29(25-15-17-26(18-16-25)37-22-20-24-11-5-2-6-12-24)34-31(38)33-28-14-8-7-13-27(28)30(36)32-21-19-23-9-3-1-4-10-23/h1-18H,19-22H2,(H,32,36)(H2,33,34,35,38) |
| InChIKey | MKTJNNFRZHGXJL-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|