C26H27N3O3S — CID 4948780
N-(2-phenylethyl)-2-[(2-propoxybenzoyl)carbamothioylamino]benzamide (PubChem CID 4948780) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is N-(2-phenylethyl)-2-[(2-propoxybenzoyl)carbamothioylamino]benzamide.
| Compound Name | N-(2-phenylethyl)-2-[(2-propoxybenzoyl)carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 4948780 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-(2-phenylethyl)-2-[(2-propoxybenzoyl)carbamothioylamino]benzamide |
| SMILES | CCCOc1ccccc1C(=O)NC(=S)Nc1ccccc1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C26H27N3O3S/c1-2-18-32-23-15-9-7-13-21(23)25(31)29-26(33)28-22-14-8-6-12-20(22)24(30)27-17-16-19-10-4-3-5-11-19/h3-15H,2,16-18H2,1H3,(H,27,30)(H2,28,29,31,33) |
| InChIKey | RLLUIJUGIPQVPD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|