C22H19BrN2O2S — CID 19628446
N-[(2-bromophenyl)carbamothioyl]-2-(2-phenylethoxy)benzamide (PubChem CID 19628446) has the molecular formula C22H19BrN2O2S and a molecular weight of 455.38 g/mol. Its IUPAC name is N-[(2-bromophenyl)carbamothioyl]-2-(2-phenylethoxy)benzamide.
| Compound Name | N-[(2-bromophenyl)carbamothioyl]-2-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 19628446 |
| Molecular Formula | C22H19BrN2O2S |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | N-[(2-bromophenyl)carbamothioyl]-2-(2-phenylethoxy)benzamide |
| SMILES | O=C(NC(=S)Nc1ccccc1Br)c1ccccc1OCCc1ccccc1 |
| InChI | InChI=1S/C22H19BrN2O2S/c23-18-11-5-6-12-19(18)24-22(28)25-21(26)17-10-4-7-13-20(17)27-15-14-16-8-2-1-3-9-16/h1-13H,14-15H2,(H2,24,25,26,28) |
| InChIKey | PFFXEWDLCJBZDH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|