C29H31N3O3S — CID 19628496
N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-2-(2-phenylethoxy)benzamide (PubChem CID 19628496) has the molecular formula C29H31N3O3S and a molecular weight of 501.65 g/mol. Its IUPAC name is N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-2-(2-phenylethoxy)benzamide.
| Compound Name | N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-2-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 19628496 |
| Molecular Formula | C29H31N3O3S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-2-(2-phenylethoxy)benzamide |
| SMILES | O=C(NC(=S)Nc1ccccc1C(=O)N1CCCCCC1)c1ccccc1OCCc1ccccc1 |
| InChI | InChI=1S/C29H31N3O3S/c33-27(24-15-7-9-17-26(24)35-21-18-22-12-4-3-5-13-22)31-29(36)30-25-16-8-6-14-23(25)28(34)32-19-10-1-2-11-20-32/h3-9,12-17H,1-2,10-11,18-21H2,(H2,30,31,33,36) |
| InChIKey | HOWOFUIGKRLTIY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|