C27H35N3O3S — CID 4942705
N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-2-hexoxybenzamide (PubChem CID 4942705) has the molecular formula C27H35N3O3S and a molecular weight of 481.66 g/mol. Its IUPAC name is N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-2-hexoxybenzamide.
| Compound Name | N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-2-hexoxybenzamide |
|---|---|
| PubChem CID | 4942705 |
| Molecular Formula | C27H35N3O3S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-2-hexoxybenzamide |
| SMILES | CCCCCCOc1ccccc1C(=O)NC(=S)Nc1ccccc1C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C27H35N3O3S/c1-2-3-4-13-20-33-24-17-10-8-15-22(24)25(31)29-27(34)28-23-16-9-7-14-21(23)26(32)30-18-11-5-6-12-19-30/h7-10,14-17H,2-6,11-13,18-20H2,1H3,(H2,28,29,31,34) |
| InChIKey | DNZAVJSBCFWONV-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|