C25H32N2O3 — CID 26167542
2-hexoxy-N-[4-(piperidine-1-carbonyl)phenyl]benzamide (PubChem CID 26167542) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is 2-hexoxy-N-[4-(piperidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 2-hexoxy-N-[4-(piperidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 26167542 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 2-hexoxy-N-[4-(piperidine-1-carbonyl)phenyl]benzamide |
| SMILES | CCCCCCOc1ccccc1C(=O)Nc1ccc(C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C25H32N2O3/c1-2-3-4-10-19-30-23-12-7-6-11-22(23)24(28)26-21-15-13-20(14-16-21)25(29)27-17-8-5-9-18-27/h6-7,11-16H,2-5,8-10,17-19H2,1H3,(H,26,28) |
| InChIKey | CAVAQIZUVUSJAG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|