C24H29N3O4S — CID 26168152
2-(2-ethoxyethoxy)-N-[[4-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide (PubChem CID 26168152) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)-N-[[4-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-(2-ethoxyethoxy)-N-[[4-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 26168152 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 2-(2-ethoxyethoxy)-N-[[4-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCOCCOc1ccccc1C(=O)NC(=S)Nc1ccc(C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H29N3O4S/c1-2-30-16-17-31-21-9-5-4-8-20(21)22(28)26-24(32)25-19-12-10-18(11-13-19)23(29)27-14-6-3-7-15-27/h4-5,8-13H,2-3,6-7,14-17H2,1H3,(H2,25,26,28,32) |
| InChIKey | MXUTWDMNVPEZDH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|