C29H31N3O4S — CID 17199366
N-[[4-(azepane-1-carbonyl)phenyl]carbamothioyl]-2-(2-phenoxyethoxy)benzamide (PubChem CID 17199366) has the molecular formula C29H31N3O4S and a molecular weight of 517.65 g/mol. Its IUPAC name is N-[[4-(azepane-1-carbonyl)phenyl]carbamothioyl]-2-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[[4-(azepane-1-carbonyl)phenyl]carbamothioyl]-2-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17199366 |
| Molecular Formula | C29H31N3O4S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | N-[[4-(azepane-1-carbonyl)phenyl]carbamothioyl]-2-(2-phenoxyethoxy)benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(C(=O)N2CCCCCC2)cc1)c1ccccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C29H31N3O4S/c33-27(25-12-6-7-13-26(25)36-21-20-35-24-10-4-3-5-11-24)31-29(37)30-23-16-14-22(15-17-23)28(34)32-18-8-1-2-9-19-32/h3-7,10-17H,1-2,8-9,18-21H2,(H2,30,31,33,37) |
| InChIKey | YHYVTYPTSBCVOU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|