C25H31N3O4S — CID 17199402
N-[[4-(azepane-1-carbonyl)phenyl]carbamothioyl]-3-(2-ethoxyethoxy)benzamide (PubChem CID 17199402) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is N-[[4-(azepane-1-carbonyl)phenyl]carbamothioyl]-3-(2-ethoxyethoxy)benzamide.
| Compound Name | N-[[4-(azepane-1-carbonyl)phenyl]carbamothioyl]-3-(2-ethoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17199402 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[[4-(azepane-1-carbonyl)phenyl]carbamothioyl]-3-(2-ethoxyethoxy)benzamide |
| SMILES | CCOCCOc1cccc(C(=O)NC(=S)Nc2ccc(C(=O)N3CCCCCC3)cc2)c1 |
| InChI | InChI=1S/C25H31N3O4S/c1-2-31-16-17-32-22-9-7-8-20(18-22)23(29)27-25(33)26-21-12-10-19(11-13-21)24(30)28-14-5-3-4-6-15-28/h7-13,18H,2-6,14-17H2,1H3,(H2,26,27,29,33) |
| InChIKey | QIKISFPJJZSWTE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|