C30H34N4O4S — CID 17334277
3-butoxy-N-[[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide (PubChem CID 17334277) has the molecular formula C30H34N4O4S and a molecular weight of 546.69 g/mol. Its IUPAC name is 3-butoxy-N-[[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3-butoxy-N-[[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17334277 |
| Molecular Formula | C30H34N4O4S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | 3-butoxy-N-[[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)NC(=S)Nc2ccc(N3CCN(C(=O)c4ccc(OC)cc4)CC3)cc2)c1 |
| InChI | InChI=1S/C30H34N4O4S/c1-3-4-20-38-27-7-5-6-23(21-27)28(35)32-30(39)31-24-10-12-25(13-11-24)33-16-18-34(19-17-33)29(36)22-8-14-26(37-2)15-9-22/h5-15,21H,3-4,16-20H2,1-2H3,(H2,31,32,35,39) |
| InChIKey | NQEGDWHHYCHXGF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|