C29H31ClN4O5S — CID 17128129
3-chloro-N-[[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-4-ethoxybenzamide (PubChem CID 17128129) has the molecular formula C29H31ClN4O5S and a molecular weight of 583.11 g/mol. Its IUPAC name is 3-chloro-N-[[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-4-ethoxybenzamide.
| Compound Name | 3-chloro-N-[[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 17128129 |
| Molecular Formula | C29H31ClN4O5S |
| Molecular Weight | 583.11 g/mol |
| Exact Mass | 582.17 |
| IUPAC Name | 3-chloro-N-[[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2ccc(N3CCN(C(=O)c4cc(OC)cc(OC)c4)CC3)cc2)cc1Cl |
| InChI | InChI=1S/C29H31ClN4O5S/c1-4-39-26-10-5-19(17-25(26)30)27(35)32-29(40)31-21-6-8-22(9-7-21)33-11-13-34(14-12-33)28(36)20-15-23(37-2)18-24(16-20)38-3/h5-10,15-18H,4,11-14H2,1-3H3,(H2,31,32,35,40) |
| InChIKey | JJXNNNAHLAICHW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.11 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|