C30H32Cl2N4O4S — CID 21171837
3-chloro-N-[[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-4-ethoxybenzamide (PubChem CID 21171837) has the molecular formula C30H32Cl2N4O4S and a molecular weight of 615.58 g/mol. Its IUPAC name is 3-chloro-N-[[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-4-ethoxybenzamide.
| Compound Name | 3-chloro-N-[[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 21171837 |
| Molecular Formula | C30H32Cl2N4O4S |
| Molecular Weight | 615.58 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | 3-chloro-N-[[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-4-ethoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)N2CCN(c3ccc(NC(=S)NC(=O)c4ccc(OCC)c(Cl)c4)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C30H32Cl2N4O4S/c1-3-17-40-23-9-5-20(6-10-23)29(38)36-15-13-35(14-16-36)26-11-8-22(19-24(26)31)33-30(41)34-28(37)21-7-12-27(39-4-2)25(32)18-21/h5-12,18-19H,3-4,13-17H2,1-2H3,(H2,33,34,37,41) |
| InChIKey | RRXLAGSSNFEGHD-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.58 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|