C24H29ClN4O4S — CID 17116068
N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3,4-dimethoxybenzamide (PubChem CID 17116068) has the molecular formula C24H29ClN4O4S and a molecular weight of 505.04 g/mol. Its IUPAC name is N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 17116068 |
| Molecular Formula | C24H29ClN4O4S |
| Molecular Weight | 505.04 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3,4-dimethoxybenzamide |
| SMILES | CCCC(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3ccc(OC)c(OC)c3)cc2Cl)CC1 |
| InChI | InChI=1S/C24H29ClN4O4S/c1-4-5-22(30)29-12-10-28(11-13-29)19-8-7-17(15-18(19)25)26-24(34)27-23(31)16-6-9-20(32-2)21(14-16)33-3/h6-9,14-15H,4-5,10-13H2,1-3H3,(H2,26,27,31,34) |
| InChIKey | VWOTXBMLRWNXTL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.04 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|