C24H28BrClN4O3S — CID 17317638
5-bromo-N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-2-methoxy-3-methylbenzamide (PubChem CID 17317638) has the molecular formula C24H28BrClN4O3S and a molecular weight of 567.94 g/mol. Its IUPAC name is 5-bromo-N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-2-methoxy-3-methylbenzamide.
| Compound Name | 5-bromo-N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-2-methoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 17317638 |
| Molecular Formula | C24H28BrClN4O3S |
| Molecular Weight | 567.94 g/mol |
| Exact Mass | 566.08 |
| IUPAC Name | 5-bromo-N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-2-methoxy-3-methylbenzamide |
| SMILES | CCCC(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3cc(Br)cc(C)c3OC)cc2Cl)CC1 |
| InChI | InChI=1S/C24H28BrClN4O3S/c1-4-5-21(31)30-10-8-29(9-11-30)20-7-6-17(14-19(20)26)27-24(34)28-23(32)18-13-16(25)12-15(2)22(18)33-3/h6-7,12-14H,4-5,8-11H2,1-3H3,(H2,27,28,32,34) |
| InChIKey | IORZLJXCNVUBTC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.94 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|