C23H26Br2ClN3O3 — CID 17358411
3,5-dibromo-N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-2-methoxybenzamide (PubChem CID 17358411) has the molecular formula C23H26Br2ClN3O3 and a molecular weight of 587.74 g/mol. Its IUPAC name is 3,5-dibromo-N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-2-methoxybenzamide.
| Compound Name | 3,5-dibromo-N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 17358411 |
| Molecular Formula | C23H26Br2ClN3O3 |
| Molecular Weight | 587.74 g/mol |
| Exact Mass | 585.00 |
| IUPAC Name | 3,5-dibromo-N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-2-methoxybenzamide |
| SMILES | COc1c(Br)cc(Br)cc1C(=O)Nc1ccc(N2CCN(C(=O)CC(C)C)CC2)c(Cl)c1 |
| InChI | InChI=1S/C23H26Br2ClN3O3/c1-14(2)10-21(30)29-8-6-28(7-9-29)20-5-4-16(13-19(20)26)27-23(31)17-11-15(24)12-18(25)22(17)32-3/h4-5,11-14H,6-10H2,1-3H3,(H,27,31) |
| InChIKey | PZECCFGVLHOCMX-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.74 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|