C22H25ClIN3O2 — CID 17050224
N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-3-iodobenzamide (PubChem CID 17050224) has the molecular formula C22H25ClIN3O2 and a molecular weight of 525.82 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-3-iodobenzamide.
| Compound Name | N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 17050224 |
| Molecular Formula | C22H25ClIN3O2 |
| Molecular Weight | 525.82 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-3-iodobenzamide |
| SMILES | CC(C)CC(=O)N1CCN(c2ccc(NC(=O)c3cccc(I)c3)cc2Cl)CC1 |
| InChI | InChI=1S/C22H25ClIN3O2/c1-15(2)12-21(28)27-10-8-26(9-11-27)20-7-6-18(14-19(20)23)25-22(29)16-4-3-5-17(24)13-16/h3-7,13-15H,8-12H2,1-2H3,(H,25,29) |
| InChIKey | HHMSUZRZBIKSHW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.82 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|