C17H21Cl4N3O2 — CID 17358214
2,2,2-trichloro-N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 17358214) has the molecular formula C17H21Cl4N3O2 and a molecular weight of 441.19 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 17358214 |
| Molecular Formula | C17H21Cl4N3O2 |
| Molecular Weight | 441.19 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 2,2,2-trichloro-N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | CC(C)CC(=O)N1CCN(c2ccc(NC(=O)C(Cl)(Cl)Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C17H21Cl4N3O2/c1-11(2)9-15(25)24-7-5-23(6-8-24)14-4-3-12(10-13(14)18)22-16(26)17(19,20)21/h3-4,10-11H,5-9H2,1-2H3,(H,22,26) |
| InChIKey | RFTOQJAGVMSRKY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.19 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|