C26H27Cl2N3O2 — CID 17358577
5-chloro-N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]naphthalene-1-carboxamide (PubChem CID 17358577) has the molecular formula C26H27Cl2N3O2 and a molecular weight of 484.43 g/mol. Its IUPAC name is 5-chloro-N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]naphthalene-1-carboxamide.
| Compound Name | 5-chloro-N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 17358577 |
| Molecular Formula | C26H27Cl2N3O2 |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 5-chloro-N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]naphthalene-1-carboxamide |
| SMILES | CC(C)CC(=O)N1CCN(c2ccc(NC(=O)c3cccc4c(Cl)cccc34)cc2Cl)CC1 |
| InChI | InChI=1S/C26H27Cl2N3O2/c1-17(2)15-25(32)31-13-11-30(12-14-31)24-10-9-18(16-23(24)28)29-26(33)21-7-3-6-20-19(21)5-4-8-22(20)27/h3-10,16-17H,11-15H2,1-2H3,(H,29,33) |
| InChIKey | YEAVZQQCLAYHKG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|