C24H25Cl2N3O2S — CID 17358351
3-chloro-N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 17358351) has the molecular formula C24H25Cl2N3O2S and a molecular weight of 490.46 g/mol. Its IUPAC name is 3-chloro-N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17358351 |
| Molecular Formula | C24H25Cl2N3O2S |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 3-chloro-N-[3-chloro-4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)CC(=O)N1CCN(c2ccc(NC(=O)c3sc4ccccc4c3Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C24H25Cl2N3O2S/c1-15(2)13-21(30)29-11-9-28(10-12-29)19-8-7-16(14-18(19)25)27-24(31)23-22(26)17-5-3-4-6-20(17)32-23/h3-8,14-15H,9-13H2,1-2H3,(H,27,31) |
| InChIKey | CWCADBFETQTOTJ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|